C6H6BrNO3 — CID 166604179
4-(bromomethyl)-5-methyl-1,2-oxazole-3-carboxylic acid (PubChem CID 166604179) has the molecular formula C6H6BrNO3 and a molecular weight of 220.02 g/mol. Its IUPAC name is 4-(bromomethyl)-5-methyl-1,2-oxazole-3-carboxylic acid.
| Compound Name | 4-(bromomethyl)-5-methyl-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 166604179 |
| Molecular Formula | C6H6BrNO3 |
| Molecular Weight | 220.02 g/mol |
| Exact Mass | 218.95 |
| IUPAC Name | 4-(bromomethyl)-5-methyl-1,2-oxazole-3-carboxylic acid |
| SMILES | Cc1onc(C(=O)O)c1CBr |
| InChI | InChI=1S/C6H6BrNO3/c1-3-4(2-7)5(6(9)10)8-11-3/h2H2,1H3,(H,9,10) |
| InChIKey | OJDBUEGCFAAUJU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.02 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|