C8H10IN3O3 — CID 166604211
(4-iodo-6-oxopyridazin-1-yl)methyl N,N-dimethylcarbamate (PubChem CID 166604211) has the molecular formula C8H10IN3O3 and a molecular weight of 323.09 g/mol. Its IUPAC name is (4-iodo-6-oxopyridazin-1-yl)methyl N,N-dimethylcarbamate.
| Compound Name | (4-iodo-6-oxopyridazin-1-yl)methyl N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 166604211 |
| Molecular Formula | C8H10IN3O3 |
| Molecular Weight | 323.09 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | (4-iodo-6-oxopyridazin-1-yl)methyl N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OCn1ncc(I)cc1=O |
| InChI | InChI=1S/C8H10IN3O3/c1-11(2)8(14)15-5-12-7(13)3-6(9)4-10-12/h3-4H,5H2,1-2H3 |
| InChIKey | IBYQABACIDOVDU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.09 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|