C15H14FN5O2 — CID 166604514
7-[[1-(3-fluorophenyl)triazol-4-yl]methyl]-5,7-diazaspiro[3.4]octane-6,8-dione (PubChem CID 166604514) has the molecular formula C15H14FN5O2 and a molecular weight of 315.31 g/mol. Its IUPAC name is 7-[[1-(3-fluorophenyl)triazol-4-yl]methyl]-5,7-diazaspiro[3.4]octane-6,8-dione.
| Compound Name | 7-[[1-(3-fluorophenyl)triazol-4-yl]methyl]-5,7-diazaspiro[3.4]octane-6,8-dione |
|---|---|
| PubChem CID | 166604514 |
| Molecular Formula | C15H14FN5O2 |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 7-[[1-(3-fluorophenyl)triazol-4-yl]methyl]-5,7-diazaspiro[3.4]octane-6,8-dione |
| SMILES | O=C1NC2(CCC2)C(=O)N1Cc1cn(-c2cccc(F)c2)nn1 |
| InChI | InChI=1S/C15H14FN5O2/c16-10-3-1-4-12(7-10)21-9-11(18-19-21)8-20-13(22)15(5-2-6-15)17-14(20)23/h1,3-4,7,9H,2,5-6,8H2,(H,17,23) |
| InChIKey | AMIVVOQNTVFWLH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|