About 2-[2-[(4-chlorophenyl)sulfonylmethyl]-5-fluoro-1H-indol-3-yl]-N,N-dimethylethanamine
2-[2-[(4-chlorophenyl)sulfonylmethyl]-5-fluoro-1H-indol-3-yl]-N,N-dimethylethanamine (PubChem CID 16660530) has the molecular formula C19H20ClFN2O2S
and a molecular weight of 394.90 g/mol. Its IUPAC name is 2-[2-[(4-chlorophenyl)sulfonylmethyl]-5-fluoro-1H-indol-3-yl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[2-[(4-chlorophenyl)sulfonylmethyl]-5-fluoro-1H-indol-3-yl]-N,N-dimethylethanamine |
| PubChem CID | 16660530 |
| Molecular Formula | C19H20ClFN2O2S |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 2-[2-[(4-chlorophenyl)sulfonylmethyl]-5-fluoro-1H-indol-3-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCc1c(CS(=O)(=O)c2ccc(Cl)cc2)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C19H20ClFN2O2S/c1-23(2)10-9-16-17-11-14(21)5-8-18(17)22-19(16)12-26(24,25)15-6-3-13(20)4-7-15/h3-8,11,22H,9-10,12H2,1-2H3 |
| InChIKey | YWNDOWVHSNROCC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(4-chlorophenyl)sulfonylmethyl]-5-fluoro-1H-indol-3-yl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(4-chlorophenyl)sulfonylmethyl]-5-fluoro-1H-indol-3-yl]-N,N-dimethylethanamine?
The IUPAC name of 2-[2-[(4-chlorophenyl)sulfonylmethyl]-5-fluoro-1H-indol-3-yl]-N,N-dimethylethanamine (CID 16660530) is 2-[2-[(4-chlorophenyl)sulfonylmethyl]-5-fluoro-1H-indol-3-yl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[2-[(4-chlorophenyl)sulfonylmethyl]-5-fluoro-1H-indol-3-yl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[2-[(4-chlorophenyl)sulfonylmethyl]-5-fluoro-1H-indol-3-yl]-N,N-dimethylethanamine is CN(C)CCc1c(CS(=O)(=O)c2ccc(Cl)cc2)[nH]c2ccc(F)cc12.
What is the InChIKey of 2-[2-[(4-chlorophenyl)sulfonylmethyl]-5-fluoro-1H-indol-3-yl]-N,N-dimethylethanamine?
The InChIKey is YWNDOWVHSNROCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClFN2O2S/c1-23(2)10-9-16-17-11-14(21)5-8-18(17)22-19(16)12-26(24,25)15-6-3-13(20)4-7-15/h3-8,11,22H,9-10,12H2,1-2H3.
What are the key properties of 2-[2-[(4-chlorophenyl)sulfonylmethyl]-5-fluoro-1H-indol-3-yl]-N,N-dimethylethanamine?
2-[2-[(4-chlorophenyl)sulfonylmethyl]-5-fluoro-1H-indol-3-yl]-N,N-dimethylethanamine has a molecular weight of 394.90 g/mol, XLogP of 4.04, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(4-chlorophenyl)sulfonylmethyl]-5-fluoro-1H-indol-3-yl]-N,N-dimethylethanamine is sourced from PubChem (CID 16660530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).