C20H24FN7 — CID 166605404
3-fluoro-2-[4-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]piperazin-1-yl]benzonitrile (PubChem CID 166605404) has the molecular formula C20H24FN7 and a molecular weight of 381.46 g/mol. Its IUPAC name is 3-fluoro-2-[4-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]piperazin-1-yl]benzonitrile.
| Compound Name | 3-fluoro-2-[4-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 166605404 |
| Molecular Formula | C20H24FN7 |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 3-fluoro-2-[4-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]piperazin-1-yl]benzonitrile |
| SMILES | CN1CCN(c2cc(N3CCN(c4c(F)cccc4C#N)CC3)ncn2)CC1 |
| InChI | InChI=1S/C20H24FN7/c1-25-5-7-26(8-6-25)18-13-19(24-15-23-18)27-9-11-28(12-10-27)20-16(14-22)3-2-4-17(20)21/h2-4,13,15H,5-12H2,1H3 |
| InChIKey | WYGRBOOLFGHKNH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 62.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |