C17H25FN4O — CID 166605983
N-[1-(6-ethyl-5-fluoropyrimidin-4-yl)piperidin-3-yl]-N-methylcyclobutanecarboxamide (PubChem CID 166605983) has the molecular formula C17H25FN4O and a molecular weight of 320.41 g/mol. Its IUPAC name is N-[1-(6-ethyl-5-fluoropyrimidin-4-yl)piperidin-3-yl]-N-methylcyclobutanecarboxamide.
| Compound Name | N-[1-(6-ethyl-5-fluoropyrimidin-4-yl)piperidin-3-yl]-N-methylcyclobutanecarboxamide |
|---|---|
| PubChem CID | 166605983 |
| Molecular Formula | C17H25FN4O |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | N-[1-(6-ethyl-5-fluoropyrimidin-4-yl)piperidin-3-yl]-N-methylcyclobutanecarboxamide |
| SMILES | CCc1ncnc(N2CCCC(N(C)C(=O)C3CCC3)C2)c1F |
| InChI | InChI=1S/C17H25FN4O/c1-3-14-15(18)16(20-11-19-14)22-9-5-8-13(10-22)21(2)17(23)12-6-4-7-12/h11-13H,3-10H2,1-2H3 |
| InChIKey | OMWVFXAEEWOILG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |