About 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-amine;dihydrochloride
1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-amine;dihydrochloride (PubChem CID 166606235) has the molecular formula C8H17Cl2N5
and a molecular weight of 254.16 g/mol. Its IUPAC name is 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-amine;dihydrochloride.
Molecular Properties
| Compound Name | 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-amine;dihydrochloride |
| PubChem CID | 166606235 |
| Molecular Formula | C8H17Cl2N5 |
| Molecular Weight | 254.16 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-amine;dihydrochloride |
| SMILES | Cl.Cl.Cn1cnnc1CN1CCC(N)C1 |
| InChI | InChI=1S/C8H15N5.2ClH/c1-12-6-10-11-8(12)5-13-3-2-7(9)4-13;;/h6-7H,2-5,9H2,1H3;2*1H |
| InChIKey | JWOVQQNSKRZCDH-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.16 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-amine;dihydrochloride?
The IUPAC name of 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-amine;dihydrochloride (CID 166606235) is 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-amine;dihydrochloride.
What is the SMILES notation for 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-amine;dihydrochloride?
The canonical SMILES for 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-amine;dihydrochloride is Cl.Cl.Cn1cnnc1CN1CCC(N)C1.
What is the InChIKey of 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-amine;dihydrochloride?
The InChIKey is JWOVQQNSKRZCDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N5.2ClH/c1-12-6-10-11-8(12)5-13-3-2-7(9)4-13;;/h6-7H,2-5,9H2,1H3;2*1H.
What are the key properties of 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-amine;dihydrochloride?
1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-amine;dihydrochloride has a molecular weight of 254.16 g/mol, XLogP of 0.19, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyrrolidin-3-amine;dihydrochloride is sourced from PubChem (CID 166606235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).