About 10-(4-tert-butylphenyl)-3,7-dimethoxyphenothiazine
10-(4-tert-butylphenyl)-3,7-dimethoxyphenothiazine (PubChem CID 166606855) has the molecular formula C24H25NO2S
and a molecular weight of 391.54 g/mol. Its IUPAC name is 10-(4-tert-butylphenyl)-3,7-dimethoxyphenothiazine.
Molecular Properties
| Compound Name | 10-(4-tert-butylphenyl)-3,7-dimethoxyphenothiazine |
| PubChem CID | 166606855 |
| Molecular Formula | C24H25NO2S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 10-(4-tert-butylphenyl)-3,7-dimethoxyphenothiazine |
| SMILES | COc1ccc2c(c1)Sc1cc(OC)ccc1N2c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H25NO2S/c1-24(2,3)16-6-8-17(9-7-16)25-20-12-10-18(26-4)14-22(20)28-23-15-19(27-5)11-13-21(23)25/h6-15H,1-5H3 |
| InChIKey | WCANKHPQAQKDQR-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10-(4-tert-butylphenyl)-3,7-dimethoxyphenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(4-tert-butylphenyl)-3,7-dimethoxyphenothiazine?
The IUPAC name of 10-(4-tert-butylphenyl)-3,7-dimethoxyphenothiazine (CID 166606855) is 10-(4-tert-butylphenyl)-3,7-dimethoxyphenothiazine.
What is the SMILES notation for 10-(4-tert-butylphenyl)-3,7-dimethoxyphenothiazine?
The canonical SMILES for 10-(4-tert-butylphenyl)-3,7-dimethoxyphenothiazine is COc1ccc2c(c1)Sc1cc(OC)ccc1N2c1ccc(C(C)(C)C)cc1.
What is the InChIKey of 10-(4-tert-butylphenyl)-3,7-dimethoxyphenothiazine?
The InChIKey is WCANKHPQAQKDQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25NO2S/c1-24(2,3)16-6-8-17(9-7-16)25-20-12-10-18(26-4)14-22(20)28-23-15-19(27-5)11-13-21(23)25/h6-15H,1-5H3.
What are the key properties of 10-(4-tert-butylphenyl)-3,7-dimethoxyphenothiazine?
10-(4-tert-butylphenyl)-3,7-dimethoxyphenothiazine has a molecular weight of 391.54 g/mol, XLogP of 6.94, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(4-tert-butylphenyl)-3,7-dimethoxyphenothiazine is sourced from PubChem (CID 166606855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).