C7H10O6 — CID 166607344
(1S,2R,4R,5S,6S)-2,4,5-trihydroxy-7-oxabicyclo[4.1.0]heptane-2-carboxylic acid (PubChem CID 166607344) has the molecular formula C7H10O6 and a molecular weight of 190.15 g/mol. Its IUPAC name is (1S,2R,4R,5S,6S)-2,4,5-trihydroxy-7-oxabicyclo[4.1.0]heptane-2-carboxylic acid.
| Compound Name | (1S,2R,4R,5S,6S)-2,4,5-trihydroxy-7-oxabicyclo[4.1.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 166607344 |
| Molecular Formula | C7H10O6 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | (1S,2R,4R,5S,6S)-2,4,5-trihydroxy-7-oxabicyclo[4.1.0]heptane-2-carboxylic acid |
| SMILES | O=C(O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C7H10O6/c8-2-1-7(12,6(10)11)5-4(13-5)3(2)9/h2-5,8-9,12H,1H2,(H,10,11)/t2-,3+,4+,5+,7-/m1/s1 |
| InChIKey | ASWQMJLBZXDZCM-WPCLBDJUSA-N |
| XLogP | -2.31 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|