C48H72Cl5N3Pd — CID 166607373
3-chloropyridine;4,5-dichloro-1,3-bis[2,6-di(heptan-4-yl)phenyl]-2H-imidazole;dichloropalladium (PubChem CID 166607373) has the molecular formula C48H72Cl5N3Pd and a molecular weight of 974.81 g/mol. Its IUPAC name is 3-chloropyridine;4,5-dichloro-1,3-bis[2,6-di(heptan-4-yl)phenyl]-2H-imidazole;dichloropalladium.
| Compound Name | 3-chloropyridine;4,5-dichloro-1,3-bis[2,6-di(heptan-4-yl)phenyl]-2H-imidazole;dichloropalladium |
|---|---|
| PubChem CID | 166607373 |
| Molecular Formula | C48H72Cl5N3Pd |
| Molecular Weight | 974.81 g/mol |
| Exact Mass | 971.32 |
| IUPAC Name | 3-chloropyridine;4,5-dichloro-1,3-bis[2,6-di(heptan-4-yl)phenyl]-2H-imidazole;dichloropalladium |
| SMILES | CCCC(CCC)c1cccc(C(CCC)CCC)c1N1CN(c2c(C(CCC)CCC)cccc2C(CCC)CCC)C(Cl)=C1Cl.Cl[Pd]Cl.Clc1cccnc1 |
| InChI | InChI=1S/C43H68Cl2N2.C5H4ClN.2ClH.Pd/c1-9-19-32(20-10-2)36-27-17-28-37(33(21-11-3)22-12-4)40(36)46-31-47(43(45)42(46)44)41-38(34(23-13-5)24-14-6)29-18-30-39(41)35(25-15-7)26-16-8;6-5-2-1-3-7-4-5;;;/h17-18,27-30,32-35H,9-16,19-26,31H2,1-8H3;1-4H;2*1H;/q;;;;+2/p-2 |
| InChIKey | JISKAUJJVRZVFY-UHFFFAOYSA-L |
| XLogP | 18.42 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 974.81 |
| LogP ≤ 5 | 18.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|