About methyl 2-chloro-5-(3-methyl-1,2,4-triazol-1-yl)benzoate
methyl 2-chloro-5-(3-methyl-1,2,4-triazol-1-yl)benzoate (PubChem CID 166607583) has the molecular formula C11H10ClN3O2
and a molecular weight of 251.67 g/mol. Its IUPAC name is methyl 2-chloro-5-(3-methyl-1,2,4-triazol-1-yl)benzoate.
Molecular Properties
| Compound Name | methyl 2-chloro-5-(3-methyl-1,2,4-triazol-1-yl)benzoate |
| PubChem CID | 166607583 |
| Molecular Formula | C11H10ClN3O2 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | methyl 2-chloro-5-(3-methyl-1,2,4-triazol-1-yl)benzoate |
| SMILES | COC(=O)c1cc(-n2cnc(C)n2)ccc1Cl |
| InChI | InChI=1S/C11H10ClN3O2/c1-7-13-6-15(14-7)8-3-4-10(12)9(5-8)11(16)17-2/h3-6H,1-2H3 |
| InChIKey | HZHBNWWMXUXNCV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-chloro-5-(3-methyl-1,2,4-triazol-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-chloro-5-(3-methyl-1,2,4-triazol-1-yl)benzoate?
The IUPAC name of methyl 2-chloro-5-(3-methyl-1,2,4-triazol-1-yl)benzoate (CID 166607583) is methyl 2-chloro-5-(3-methyl-1,2,4-triazol-1-yl)benzoate.
What is the SMILES notation for methyl 2-chloro-5-(3-methyl-1,2,4-triazol-1-yl)benzoate?
The canonical SMILES for methyl 2-chloro-5-(3-methyl-1,2,4-triazol-1-yl)benzoate is COC(=O)c1cc(-n2cnc(C)n2)ccc1Cl.
What is the InChIKey of methyl 2-chloro-5-(3-methyl-1,2,4-triazol-1-yl)benzoate?
The InChIKey is HZHBNWWMXUXNCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClN3O2/c1-7-13-6-15(14-7)8-3-4-10(12)9(5-8)11(16)17-2/h3-6H,1-2H3.
What are the key properties of methyl 2-chloro-5-(3-methyl-1,2,4-triazol-1-yl)benzoate?
methyl 2-chloro-5-(3-methyl-1,2,4-triazol-1-yl)benzoate has a molecular weight of 251.67 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-chloro-5-(3-methyl-1,2,4-triazol-1-yl)benzoate is sourced from PubChem (CID 166607583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).