About 6-cyclopropyl-2,1-benzoxazol-3-amine
6-cyclopropyl-2,1-benzoxazol-3-amine (PubChem CID 166607767) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is 6-cyclopropyl-2,1-benzoxazol-3-amine.
Molecular Properties
| Compound Name | 6-cyclopropyl-2,1-benzoxazol-3-amine |
| PubChem CID | 166607767 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 6-cyclopropyl-2,1-benzoxazol-3-amine |
| SMILES | Nc1onc2cc(C3CC3)ccc12 |
| InChI | InChI=1S/C10H10N2O/c11-10-8-4-3-7(6-1-2-6)5-9(8)12-13-10/h3-6H,1-2,11H2 |
| InChIKey | NGYZFDKAHJVPAX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-cyclopropyl-2,1-benzoxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopropyl-2,1-benzoxazol-3-amine?
The IUPAC name of 6-cyclopropyl-2,1-benzoxazol-3-amine (CID 166607767) is 6-cyclopropyl-2,1-benzoxazol-3-amine.
What is the SMILES notation for 6-cyclopropyl-2,1-benzoxazol-3-amine?
The canonical SMILES for 6-cyclopropyl-2,1-benzoxazol-3-amine is Nc1onc2cc(C3CC3)ccc12.
What is the InChIKey of 6-cyclopropyl-2,1-benzoxazol-3-amine?
The InChIKey is NGYZFDKAHJVPAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c11-10-8-4-3-7(6-1-2-6)5-9(8)12-13-10/h3-6H,1-2,11H2.
What are the key properties of 6-cyclopropyl-2,1-benzoxazol-3-amine?
6-cyclopropyl-2,1-benzoxazol-3-amine has a molecular weight of 174.20 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopropyl-2,1-benzoxazol-3-amine is sourced from PubChem (CID 166607767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).