About 2,2-difluoro-4,6-dimethoxy-1,3-benzodioxole
2,2-difluoro-4,6-dimethoxy-1,3-benzodioxole (PubChem CID 166608241) has the molecular formula C9H8F2O4
and a molecular weight of 218.15 g/mol. Its IUPAC name is 2,2-difluoro-4,6-dimethoxy-1,3-benzodioxole.
Molecular Properties
| Compound Name | 2,2-difluoro-4,6-dimethoxy-1,3-benzodioxole |
| PubChem CID | 166608241 |
| Molecular Formula | C9H8F2O4 |
| Molecular Weight | 218.15 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 2,2-difluoro-4,6-dimethoxy-1,3-benzodioxole |
| SMILES | COc1cc(OC)c2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C9H8F2O4/c1-12-5-3-6(13-2)8-7(4-5)14-9(10,11)15-8/h3-4H,1-2H3 |
| InChIKey | NRIQRZIDTZUOBT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.15 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-difluoro-4,6-dimethoxy-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-4,6-dimethoxy-1,3-benzodioxole?
The IUPAC name of 2,2-difluoro-4,6-dimethoxy-1,3-benzodioxole (CID 166608241) is 2,2-difluoro-4,6-dimethoxy-1,3-benzodioxole.
What is the SMILES notation for 2,2-difluoro-4,6-dimethoxy-1,3-benzodioxole?
The canonical SMILES for 2,2-difluoro-4,6-dimethoxy-1,3-benzodioxole is COc1cc(OC)c2c(c1)OC(F)(F)O2.
What is the InChIKey of 2,2-difluoro-4,6-dimethoxy-1,3-benzodioxole?
The InChIKey is NRIQRZIDTZUOBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2O4/c1-12-5-3-6(13-2)8-7(4-5)14-9(10,11)15-8/h3-4H,1-2H3.
What are the key properties of 2,2-difluoro-4,6-dimethoxy-1,3-benzodioxole?
2,2-difluoro-4,6-dimethoxy-1,3-benzodioxole has a molecular weight of 218.15 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-4,6-dimethoxy-1,3-benzodioxole is sourced from PubChem (CID 166608241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).