About 3-(2,3,6-trifluorophenyl)azetidin-3-amine
3-(2,3,6-trifluorophenyl)azetidin-3-amine (PubChem CID 166608665) has the molecular formula C9H9F3N2
and a molecular weight of 202.18 g/mol. Its IUPAC name is 3-(2,3,6-trifluorophenyl)azetidin-3-amine.
Molecular Properties
| Compound Name | 3-(2,3,6-trifluorophenyl)azetidin-3-amine |
| PubChem CID | 166608665 |
| Molecular Formula | C9H9F3N2 |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 3-(2,3,6-trifluorophenyl)azetidin-3-amine |
| SMILES | NC1(c2c(F)ccc(F)c2F)CNC1 |
| InChI | InChI=1S/C9H9F3N2/c10-5-1-2-6(11)8(12)7(5)9(13)3-14-4-9/h1-2,14H,3-4,13H2 |
| InChIKey | VMSRLHYOXFETGP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3,6-trifluorophenyl)azetidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3,6-trifluorophenyl)azetidin-3-amine?
The IUPAC name of 3-(2,3,6-trifluorophenyl)azetidin-3-amine (CID 166608665) is 3-(2,3,6-trifluorophenyl)azetidin-3-amine.
What is the SMILES notation for 3-(2,3,6-trifluorophenyl)azetidin-3-amine?
The canonical SMILES for 3-(2,3,6-trifluorophenyl)azetidin-3-amine is NC1(c2c(F)ccc(F)c2F)CNC1.
What is the InChIKey of 3-(2,3,6-trifluorophenyl)azetidin-3-amine?
The InChIKey is VMSRLHYOXFETGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3N2/c10-5-1-2-6(11)8(12)7(5)9(13)3-14-4-9/h1-2,14H,3-4,13H2.
What are the key properties of 3-(2,3,6-trifluorophenyl)azetidin-3-amine?
3-(2,3,6-trifluorophenyl)azetidin-3-amine has a molecular weight of 202.18 g/mol, XLogP of 0.86, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3,6-trifluorophenyl)azetidin-3-amine is sourced from PubChem (CID 166608665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).