C9H10ClF3N2 — CID 166608984
3-(2,3,5-trifluorophenyl)azetidin-3-amine;hydrochloride (PubChem CID 166608984) has the molecular formula C9H10ClF3N2 and a molecular weight of 238.64 g/mol. Its IUPAC name is 3-(2,3,5-trifluorophenyl)azetidin-3-amine;hydrochloride.
| Compound Name | 3-(2,3,5-trifluorophenyl)azetidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 166608984 |
| Molecular Formula | C9H10ClF3N2 |
| Molecular Weight | 238.64 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 3-(2,3,5-trifluorophenyl)azetidin-3-amine;hydrochloride |
| SMILES | Cl.NC1(c2cc(F)cc(F)c2F)CNC1 |
| InChI | InChI=1S/C9H9F3N2.ClH/c10-5-1-6(8(12)7(11)2-5)9(13)3-14-4-9;/h1-2,14H,3-4,13H2;1H |
| InChIKey | ARNDAYFEGVUXDS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.64 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|