C17H21BN2O3S — CID 166609060
1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]pyrrolidin-2-one (PubChem CID 166609060) has the molecular formula C17H21BN2O3S and a molecular weight of 344.25 g/mol. Its IUPAC name is 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]pyrrolidin-2-one.
| Compound Name | 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 166609060 |
| Molecular Formula | C17H21BN2O3S |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]pyrrolidin-2-one |
| SMILES | CC1(C)OB(c2ccc3sc(N4CCCC4=O)nc3c2)OC1(C)C |
| InChI | InChI=1S/C17H21BN2O3S/c1-16(2)17(3,4)23-18(22-16)11-7-8-13-12(10-11)19-15(24-13)20-9-5-6-14(20)21/h7-8,10H,5-6,9H2,1-4H3 |
| InChIKey | ULEPXXUUOUKFLN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|