C27H31ClN6O4S — CID 16660960
N-[(1R,2S,5S)-2-[(5-chloro-3-formyl-1H-indole-2-carbonyl)amino]-5-(dimethylcarbamoyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 16660960) has the molecular formula C27H31ClN6O4S and a molecular weight of 571.10 g/mol. Its IUPAC name is N-[(1R,2S,5S)-2-[(5-chloro-3-formyl-1H-indole-2-carbonyl)amino]-5-(dimethylcarbamoyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-[(1R,2S,5S)-2-[(5-chloro-3-formyl-1H-indole-2-carbonyl)amino]-5-(dimethylcarbamoyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 16660960 |
| Molecular Formula | C27H31ClN6O4S |
| Molecular Weight | 571.10 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | N-[(1R,2S,5S)-2-[(5-chloro-3-formyl-1H-indole-2-carbonyl)amino]-5-(dimethylcarbamoyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CN1CCc2nc(C(=O)N[C@@H]3C[C@@H](C(=O)N(C)C)CC[C@@H]3NC(=O)c3[nH]c4ccc(Cl)cc4c3C=O)sc2C1 |
| InChI | InChI=1S/C27H31ClN6O4S/c1-33(2)27(38)14-4-6-19(30-24(36)23-17(13-35)16-11-15(28)5-7-18(16)29-23)21(10-14)31-25(37)26-32-20-8-9-34(3)12-22(20)39-26/h5,7,11,13-14,19,21,29H,4,6,8-10,12H2,1-3H3,(H,30,36)(H,31,37)/t14-,19-,21+/m0/s1 |
| InChIKey | CFKFDPIYKGDUPV-ONTRVFCTSA-N |
| XLogP | 2.86 |
| TPSA | 127.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.10 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|