C9H2Cl5N — CID 166610359
1,3,5,6,7-pentachloroisoquinoline (PubChem CID 166610359) has the molecular formula C9H2Cl5N and a molecular weight of 301.39 g/mol. Its IUPAC name is 1,3,5,6,7-pentachloroisoquinoline.
| Compound Name | 1,3,5,6,7-pentachloroisoquinoline |
|---|---|
| PubChem CID | 166610359 |
| Molecular Formula | C9H2Cl5N |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 298.86 |
| IUPAC Name | 1,3,5,6,7-pentachloroisoquinoline |
| SMILES | Clc1cc2c(Cl)c(Cl)c(Cl)cc2c(Cl)n1 |
| InChI | InChI=1S/C9H2Cl5N/c10-5-1-4-3(7(12)8(5)13)2-6(11)15-9(4)14/h1-2H |
| InChIKey | ZCCYISRILOWPFZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|