C9H4F8O — CID 166610404
2-(2,4-difluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 166610404) has the molecular formula C9H4F8O and a molecular weight of 280.11 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 166610404 |
| Molecular Formula | C9H4F8O |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(c1ccc(F)cc1F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H4F8O/c10-4-1-2-5(6(11)3-4)7(18,8(12,13)14)9(15,16)17/h1-3,18H |
| InChIKey | POLDTZHQAHKKKR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |