About 7-chloro-2,2-dimethyl-3,4-dihydronaphthalen-1-one
7-chloro-2,2-dimethyl-3,4-dihydronaphthalen-1-one (PubChem CID 166610621) has the molecular formula C12H13ClO
and a molecular weight of 208.69 g/mol. Its IUPAC name is 7-chloro-2,2-dimethyl-3,4-dihydronaphthalen-1-one.
Molecular Properties
| Compound Name | 7-chloro-2,2-dimethyl-3,4-dihydronaphthalen-1-one |
| PubChem CID | 166610621 |
| Molecular Formula | C12H13ClO |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 7-chloro-2,2-dimethyl-3,4-dihydronaphthalen-1-one |
| SMILES | CC1(C)CCc2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C12H13ClO/c1-12(2)6-5-8-3-4-9(13)7-10(8)11(12)14/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | PUDUHOFSZIDPSK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-chloro-2,2-dimethyl-3,4-dihydronaphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2,2-dimethyl-3,4-dihydronaphthalen-1-one?
The IUPAC name of 7-chloro-2,2-dimethyl-3,4-dihydronaphthalen-1-one (CID 166610621) is 7-chloro-2,2-dimethyl-3,4-dihydronaphthalen-1-one.
What is the SMILES notation for 7-chloro-2,2-dimethyl-3,4-dihydronaphthalen-1-one?
The canonical SMILES for 7-chloro-2,2-dimethyl-3,4-dihydronaphthalen-1-one is CC1(C)CCc2ccc(Cl)cc2C1=O.
What is the InChIKey of 7-chloro-2,2-dimethyl-3,4-dihydronaphthalen-1-one?
The InChIKey is PUDUHOFSZIDPSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClO/c1-12(2)6-5-8-3-4-9(13)7-10(8)11(12)14/h3-4,7H,5-6H2,1-2H3.
What are the key properties of 7-chloro-2,2-dimethyl-3,4-dihydronaphthalen-1-one?
7-chloro-2,2-dimethyl-3,4-dihydronaphthalen-1-one has a molecular weight of 208.69 g/mol, XLogP of 3.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2,2-dimethyl-3,4-dihydronaphthalen-1-one is sourced from PubChem (CID 166610621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).