C14H17N5OS — CID 166610801
1-[(E)-N'-(4,5-dimethyl-1,3-thiazol-2-yl)carbamimidoyl]-3-(2-methylphenyl)urea (PubChem CID 166610801) has the molecular formula C14H17N5OS and a molecular weight of 303.39 g/mol. Its IUPAC name is 1-[(E)-N'-(4,5-dimethyl-1,3-thiazol-2-yl)carbamimidoyl]-3-(2-methylphenyl)urea.
| Compound Name | 1-[(E)-N'-(4,5-dimethyl-1,3-thiazol-2-yl)carbamimidoyl]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 166610801 |
| Molecular Formula | C14H17N5OS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-[(E)-N'-(4,5-dimethyl-1,3-thiazol-2-yl)carbamimidoyl]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)N/C(N)=N/c1nc(C)c(C)s1 |
| InChI | InChI=1S/C14H17N5OS/c1-8-6-4-5-7-11(8)17-13(20)18-12(15)19-14-16-9(2)10(3)21-14/h4-7H,1-3H3,(H4,15,16,17,18,19,20) |
| InChIKey | XBQXMTMMPNSXIR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|