C15H14FN3O3 — CID 16661082
3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 16661082) has the molecular formula C15H14FN3O3 and a molecular weight of 303.29 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 16661082 |
| Molecular Formula | C15H14FN3O3 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1noc(C)c1N1C(=O)NC(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C15H14FN3O3/c1-8-13(9(2)22-18-8)19-14(20)12(17-15(19)21)7-10-3-5-11(16)6-4-10/h3-6,12H,7H2,1-2H3,(H,17,21) |
| InChIKey | HHKYTMMZOFQGFQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|