C21H19BFN3O3 — CID 166610916
[5-fluoro-2-methoxy-3-(8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)phenyl]boronic acid (PubChem CID 166610916) has the molecular formula C21H19BFN3O3 and a molecular weight of 391.21 g/mol. Its IUPAC name is [5-fluoro-2-methoxy-3-(8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)phenyl]boronic acid.
| Compound Name | [5-fluoro-2-methoxy-3-(8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 166610916 |
| Molecular Formula | C21H19BFN3O3 |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | [5-fluoro-2-methoxy-3-(8,9,10,11-tetrahydro-3H-pyrazolo[4,5-a]phenanthridin-7-yl)phenyl]boronic acid |
| SMILES | COc1c(B(O)O)cc(F)cc1-c1nc2ccc3[nH]ncc3c2c2c1CCCC2 |
| InChI | InChI=1S/C21H19BFN3O3/c1-29-21-14(8-11(23)9-16(21)22(27)28)20-13-5-3-2-4-12(13)19-15-10-24-26-17(15)6-7-18(19)25-20/h6-10,27-28H,2-5H2,1H3,(H,24,26) |
| InChIKey | CDHPWKMSJDORTK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|