About 2H-benzotriazole-4,7-diol
2H-benzotriazole-4,7-diol (PubChem CID 166611118) has the molecular formula C6H5N3O2
and a molecular weight of 151.12 g/mol. Its IUPAC name is 2H-benzotriazole-4,7-diol.
Molecular Properties
| Compound Name | 2H-benzotriazole-4,7-diol |
| PubChem CID | 166611118 |
| Molecular Formula | C6H5N3O2 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | 2H-benzotriazole-4,7-diol |
| SMILES | Oc1ccc(O)c2n[nH]nc12 |
| InChI | InChI=1S/C6H5N3O2/c10-3-1-2-4(11)6-5(3)7-9-8-6/h1-2,10-11H,(H,7,8,9) |
| InChIKey | HUBWREIDGPUPJT-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2H-benzotriazole-4,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazole-4,7-diol?
The IUPAC name of 2H-benzotriazole-4,7-diol (CID 166611118) is 2H-benzotriazole-4,7-diol.
What is the SMILES notation for 2H-benzotriazole-4,7-diol?
The canonical SMILES for 2H-benzotriazole-4,7-diol is Oc1ccc(O)c2n[nH]nc12.
What is the InChIKey of 2H-benzotriazole-4,7-diol?
The InChIKey is HUBWREIDGPUPJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O2/c10-3-1-2-4(11)6-5(3)7-9-8-6/h1-2,10-11H,(H,7,8,9).
What are the key properties of 2H-benzotriazole-4,7-diol?
2H-benzotriazole-4,7-diol has a molecular weight of 151.12 g/mol, XLogP of 0.37, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazole-4,7-diol is sourced from PubChem (CID 166611118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).