C14H18N2O2S2 — CID 166611174
N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]benzenesulfonamide (PubChem CID 166611174) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 166611174 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1nc(CNS(=O)(=O)c2ccccc2)cs1 |
| InChI | InChI=1S/C14H18N2O2S2/c1-14(2,3)13-16-11(10-19-13)9-15-20(17,18)12-7-5-4-6-8-12/h4-8,10,15H,9H2,1-3H3 |
| InChIKey | ZIQVFYKJKSXGEQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |