C20H14F2N4S2 — CID 166611230
6-amino-3,5-dicyano-2,4-bis(2-fluorophenyl)-2,4-dihydrothiopyran-3-carbothioamide (PubChem CID 166611230) has the molecular formula C20H14F2N4S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 6-amino-3,5-dicyano-2,4-bis(2-fluorophenyl)-2,4-dihydrothiopyran-3-carbothioamide.
| Compound Name | 6-amino-3,5-dicyano-2,4-bis(2-fluorophenyl)-2,4-dihydrothiopyran-3-carbothioamide |
|---|---|
| PubChem CID | 166611230 |
| Molecular Formula | C20H14F2N4S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 6-amino-3,5-dicyano-2,4-bis(2-fluorophenyl)-2,4-dihydrothiopyran-3-carbothioamide |
| SMILES | N#CC1=C(N)SC(c2ccccc2F)C(C#N)(C(N)=S)C1c1ccccc1F |
| InChI | InChI=1S/C20H14F2N4S2/c21-14-7-3-1-5-11(14)16-13(9-23)18(25)28-17(20(16,10-24)19(26)27)12-6-2-4-8-15(12)22/h1-8,16-17H,25H2,(H2,26,27) |
| InChIKey | VCSHSRMEVVMBMM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|