C17H24N6O — CID 166611741
6-ethyl-5-[4-(3-methoxyphenyl)piperazin-1-yl]pyrimidine-2,4-diamine (PubChem CID 166611741) has the molecular formula C17H24N6O and a molecular weight of 328.42 g/mol. Its IUPAC name is 6-ethyl-5-[4-(3-methoxyphenyl)piperazin-1-yl]pyrimidine-2,4-diamine.
| Compound Name | 6-ethyl-5-[4-(3-methoxyphenyl)piperazin-1-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 166611741 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 6-ethyl-5-[4-(3-methoxyphenyl)piperazin-1-yl]pyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)c1N1CCN(c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C17H24N6O/c1-3-14-15(16(18)21-17(19)20-14)23-9-7-22(8-10-23)12-5-4-6-13(11-12)24-2/h4-6,11H,3,7-10H2,1-2H3,(H4,18,19,20,21) |
| InChIKey | SSEILEKLHZLBHD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |