C18H20N8 — CID 166611752
5-[4-(3-pyridazin-3-ylphenyl)piperazin-1-yl]pyrimidine-2,4-diamine (PubChem CID 166611752) has the molecular formula C18H20N8 and a molecular weight of 348.41 g/mol. Its IUPAC name is 5-[4-(3-pyridazin-3-ylphenyl)piperazin-1-yl]pyrimidine-2,4-diamine.
| Compound Name | 5-[4-(3-pyridazin-3-ylphenyl)piperazin-1-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 166611752 |
| Molecular Formula | C18H20N8 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 5-[4-(3-pyridazin-3-ylphenyl)piperazin-1-yl]pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(N2CCN(c3cccc(-c4cccnn4)c3)CC2)c(N)n1 |
| InChI | InChI=1S/C18H20N8/c19-17-16(12-21-18(20)23-17)26-9-7-25(8-10-26)14-4-1-3-13(11-14)15-5-2-6-22-24-15/h1-6,11-12H,7-10H2,(H4,19,20,21,23) |
| InChIKey | OARVXBUGNHJOSK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |