C24H22F3N5O3S — CID 166612057
(1S,8S)-5-[[4-[(3-methylsulfonylphenyl)methylamino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-9-one (PubChem CID 166612057) has the molecular formula C24H22F3N5O3S and a molecular weight of 517.53 g/mol. Its IUPAC name is (1S,8S)-5-[[4-[(3-methylsulfonylphenyl)methylamino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-9-one.
| Compound Name | (1S,8S)-5-[[4-[(3-methylsulfonylphenyl)methylamino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-9-one |
|---|---|
| PubChem CID | 166612057 |
| Molecular Formula | C24H22F3N5O3S |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | (1S,8S)-5-[[4-[(3-methylsulfonylphenyl)methylamino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-9-one |
| SMILES | CS(=O)(=O)c1cccc(CNc2nc(Nc3ccc4c(c3)[C@@H]3C[C@@H]4CNC3=O)ncc2C(F)(F)F)c1 |
| InChI | InChI=1S/C24H22F3N5O3S/c1-36(34,35)16-4-2-3-13(7-16)10-28-21-20(24(25,26)27)12-30-23(32-21)31-15-5-6-17-14-8-19(18(17)9-15)22(33)29-11-14/h2-7,9,12,14,19H,8,10-11H2,1H3,(H,29,33)(H2,28,30,31,32)/t14-,19+/m1/s1 |
| InChIKey | ZELFHGIWCIDHCL-KUHUBIRLSA-N |
| XLogP | 3.96 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |