C30H54N4O4 — CID 166612067
(3S,14R,16S)-16-[(1R)-2-[2-[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]propan-2-ylamino]-1-hydroxyethyl]-3,4,14-trimethyl-1,4-diazacyclohexadecane-2,5-dione (PubChem CID 166612067) has the molecular formula C30H54N4O4 and a molecular weight of 534.79 g/mol. Its IUPAC name is (3S,14R,16S)-16-[(1R)-2-[2-[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]propan-2-ylamino]-1-hydroxyethyl]-3,4,14-trimethyl-1,4-diazacyclohexadecane-2,5-dione.
| Compound Name | (3S,14R,16S)-16-[(1R)-2-[2-[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]propan-2-ylamino]-1-hydroxyethyl]-3,4,14-trimethyl-1,4-diazacyclohexadecane-2,5-dione |
|---|---|
| PubChem CID | 166612067 |
| Molecular Formula | C30H54N4O4 |
| Molecular Weight | 534.79 g/mol |
| Exact Mass | 534.41 |
| IUPAC Name | (3S,14R,16S)-16-[(1R)-2-[2-[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]propan-2-ylamino]-1-hydroxyethyl]-3,4,14-trimethyl-1,4-diazacyclohexadecane-2,5-dione |
| SMILES | C[C@@H]1CCCCCCCCC(=O)N(C)[C@@H](C)C(=O)N[C@H]([C@H](O)CNC(C)(C)c2cc(CC(C)(C)C)on2)C1 |
| InChI | InChI=1S/C30H54N4O4/c1-21-15-13-11-9-10-12-14-16-27(36)34(8)22(2)28(37)32-24(17-21)25(35)20-31-30(6,7)26-18-23(38-33-26)19-29(3,4)5/h18,21-22,24-25,31,35H,9-17,19-20H2,1-8H3,(H,32,37)/t21-,22+,24+,25-/m1/s1 |
| InChIKey | CLUWBLNXFKEMJK-BPJRBCGYSA-N |
| XLogP | 4.94 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.79 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |