C28H50N4O4 — CID 166612069
(3S,14R,16S)-16-[(1R)-2-[[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]methylamino]-1-hydroxyethyl]-3,4,14-trimethyl-1,4-diazacyclohexadecane-2,5-dione (PubChem CID 166612069) has the molecular formula C28H50N4O4 and a molecular weight of 506.73 g/mol. Its IUPAC name is (3S,14R,16S)-16-[(1R)-2-[[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]methylamino]-1-hydroxyethyl]-3,4,14-trimethyl-1,4-diazacyclohexadecane-2,5-dione.
| Compound Name | (3S,14R,16S)-16-[(1R)-2-[[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]methylamino]-1-hydroxyethyl]-3,4,14-trimethyl-1,4-diazacyclohexadecane-2,5-dione |
|---|---|
| PubChem CID | 166612069 |
| Molecular Formula | C28H50N4O4 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.38 |
| IUPAC Name | (3S,14R,16S)-16-[(1R)-2-[[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]methylamino]-1-hydroxyethyl]-3,4,14-trimethyl-1,4-diazacyclohexadecane-2,5-dione |
| SMILES | C[C@@H]1CCCCCCCCC(=O)N(C)[C@@H](C)C(=O)N[C@H]([C@H](O)CNCc2cc(CC(C)(C)C)on2)C1 |
| InChI | InChI=1S/C28H50N4O4/c1-20-13-11-9-7-8-10-12-14-26(34)32(6)21(2)27(35)30-24(15-20)25(33)19-29-18-22-16-23(36-31-22)17-28(3,4)5/h16,20-21,24-25,29,33H,7-15,17-19H2,1-6H3,(H,30,35)/t20-,21+,24+,25-/m1/s1 |
| InChIKey | ATCGBECVUPMSQP-HWIPXOPOSA-N |
| XLogP | 4.21 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |