C29H52N4O4 — CID 166612070
(3S,14R,16S)-16-[(1R)-2-[[(1S)-1-[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]ethyl]amino]-1-hydroxyethyl]-3,4,14-trimethyl-1,4-diazacyclohexadecane-2,5-dione (PubChem CID 166612070) has the molecular formula C29H52N4O4 and a molecular weight of 520.76 g/mol. Its IUPAC name is (3S,14R,16S)-16-[(1R)-2-[[(1S)-1-[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]ethyl]amino]-1-hydroxyethyl]-3,4,14-trimethyl-1,4-diazacyclohexadecane-2,5-dione.
| Compound Name | (3S,14R,16S)-16-[(1R)-2-[[(1S)-1-[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]ethyl]amino]-1-hydroxyethyl]-3,4,14-trimethyl-1,4-diazacyclohexadecane-2,5-dione |
|---|---|
| PubChem CID | 166612070 |
| Molecular Formula | C29H52N4O4 |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 520.40 |
| IUPAC Name | (3S,14R,16S)-16-[(1R)-2-[[(1S)-1-[5-(2,2-dimethylpropyl)-1,2-oxazol-3-yl]ethyl]amino]-1-hydroxyethyl]-3,4,14-trimethyl-1,4-diazacyclohexadecane-2,5-dione |
| SMILES | C[C@@H]1CCCCCCCCC(=O)N(C)[C@@H](C)C(=O)N[C@H]([C@H](O)CN[C@@H](C)c2cc(CC(C)(C)C)on2)C1 |
| InChI | InChI=1S/C29H52N4O4/c1-20-14-12-10-8-9-11-13-15-27(35)33(7)22(3)28(36)31-25(16-20)26(34)19-30-21(2)24-17-23(37-32-24)18-29(4,5)6/h17,20-22,25-26,30,34H,8-16,18-19H2,1-7H3,(H,31,36)/t20-,21+,22+,25+,26-/m1/s1 |
| InChIKey | CNBUCEDWOCWNJY-HCQBBNJVSA-N |
| XLogP | 4.77 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |