C30H46N4O2 — CID 166612080
(10R,12S)-12-[(1R)-1-hydroxy-2-[(3-propan-2-ylphenyl)methylamino]ethyl]-2,10-dimethyl-2,13,18-triazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-14-one (PubChem CID 166612080) has the molecular formula C30H46N4O2 and a molecular weight of 494.72 g/mol. Its IUPAC name is (10R,12S)-12-[(1R)-1-hydroxy-2-[(3-propan-2-ylphenyl)methylamino]ethyl]-2,10-dimethyl-2,13,18-triazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-14-one.
| Compound Name | (10R,12S)-12-[(1R)-1-hydroxy-2-[(3-propan-2-ylphenyl)methylamino]ethyl]-2,10-dimethyl-2,13,18-triazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-14-one |
|---|---|
| PubChem CID | 166612080 |
| Molecular Formula | C30H46N4O2 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.36 |
| IUPAC Name | (10R,12S)-12-[(1R)-1-hydroxy-2-[(3-propan-2-ylphenyl)methylamino]ethyl]-2,10-dimethyl-2,13,18-triazabicyclo[13.3.1]nonadeca-1(18),15(19),16-trien-14-one |
| SMILES | CC(C)c1cccc(CNC[C@@H](O)[C@@H]2C[C@H](C)CCCCCCCN(C)c3cc(ccn3)C(=O)N2)c1 |
| InChI | InChI=1S/C30H46N4O2/c1-22(2)25-13-10-12-24(18-25)20-31-21-28(35)27-17-23(3)11-8-6-5-7-9-16-34(4)29-19-26(14-15-32-29)30(36)33-27/h10,12-15,18-19,22-23,27-28,31,35H,5-9,11,16-17,20-21H2,1-4H3,(H,33,36)/t23-,27+,28-/m1/s1 |
| InChIKey | CAMKVFITCFUPFN-KEKPKEOLSA-N |
| XLogP | 5.27 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |