C30H44N4O2 — CID 166612083
(9E,12S)-12-[(1R)-1-hydroxy-2-[(3-propan-2-ylphenyl)methylamino]ethyl]-10,17-dimethyl-2,13,18-triazabicyclo[13.3.1]nonadeca-1(18),9,15(19),16-tetraen-14-one (PubChem CID 166612083) has the molecular formula C30H44N4O2 and a molecular weight of 492.71 g/mol. Its IUPAC name is (9E,12S)-12-[(1R)-1-hydroxy-2-[(3-propan-2-ylphenyl)methylamino]ethyl]-10,17-dimethyl-2,13,18-triazabicyclo[13.3.1]nonadeca-1(18),9,15(19),16-tetraen-14-one.
| Compound Name | (9E,12S)-12-[(1R)-1-hydroxy-2-[(3-propan-2-ylphenyl)methylamino]ethyl]-10,17-dimethyl-2,13,18-triazabicyclo[13.3.1]nonadeca-1(18),9,15(19),16-tetraen-14-one |
|---|---|
| PubChem CID | 166612083 |
| Molecular Formula | C30H44N4O2 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | (9E,12S)-12-[(1R)-1-hydroxy-2-[(3-propan-2-ylphenyl)methylamino]ethyl]-10,17-dimethyl-2,13,18-triazabicyclo[13.3.1]nonadeca-1(18),9,15(19),16-tetraen-14-one |
| SMILES | C/C1=C\CCCCCCNc2cc(cc(C)n2)C(=O)N[C@H]([C@H](O)CNCc2cccc(C(C)C)c2)C1 |
| InChI | InChI=1S/C30H44N4O2/c1-21(2)25-13-10-12-24(17-25)19-31-20-28(35)27-15-22(3)11-8-6-5-7-9-14-32-29-18-26(30(36)34-27)16-23(4)33-29/h10-13,16-18,21,27-28,31,35H,5-9,14-15,19-20H2,1-4H3,(H,32,33)(H,34,36)/b22-11+/t27-,28+/m0/s1 |
| InChIKey | RYKUKQNZLMAEPT-IAYOVPDSSA-N |
| XLogP | 5.47 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|