C16H15F6NO2S — CID 16661344
cyclobutyl-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]methanone (PubChem CID 16661344) has the molecular formula C16H15F6NO2S and a molecular weight of 399.36 g/mol. Its IUPAC name is cyclobutyl-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]methanone.
| Compound Name | cyclobutyl-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]methanone |
|---|---|
| PubChem CID | 16661344 |
| Molecular Formula | C16H15F6NO2S |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | cyclobutyl-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]methanone |
| SMILES | O=C(C1CCC1)N1CCSc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C16H15F6NO2S/c17-15(18,19)14(25,16(20,21)22)10-4-5-11-12(8-10)26-7-6-23(11)13(24)9-2-1-3-9/h4-5,8-9,25H,1-3,6-7H2 |
| InChIKey | UCLJYMAUIGCOAE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |