C23H28N4O2 — CID 166613451
(2'S,3R)-1'-(2-methyl-4,5,6,7-tetrahydroindazole-3-carbonyl)-2'-propylspiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 166613451) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is (2'S,3R)-1'-(2-methyl-4,5,6,7-tetrahydroindazole-3-carbonyl)-2'-propylspiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (2'S,3R)-1'-(2-methyl-4,5,6,7-tetrahydroindazole-3-carbonyl)-2'-propylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 166613451 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (2'S,3R)-1'-(2-methyl-4,5,6,7-tetrahydroindazole-3-carbonyl)-2'-propylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | CCC[C@@H]1N(C(=O)c2c3c(nn2C)CCCC3)CC[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C23H28N4O2/c1-3-8-19-23(16-10-5-7-12-18(16)24-22(23)29)13-14-27(19)21(28)20-15-9-4-6-11-17(15)25-26(20)2/h5,7,10,12,19H,3-4,6,8-9,11,13-14H2,1-2H3,(H,24,29)/t19-,23+/m0/s1 |
| InChIKey | OWVJGRRAXGCUKI-WMZHIEFXSA-N |
| XLogP | 3.20 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |