C22H23N3O3 — CID 166614439
[3-[(3-hydroxyphenyl)methyl]pyrrolidin-1-yl]-[1-(2-methoxyphenyl)pyrazol-4-yl]methanone (PubChem CID 166614439) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is [3-[(3-hydroxyphenyl)methyl]pyrrolidin-1-yl]-[1-(2-methoxyphenyl)pyrazol-4-yl]methanone.
| Compound Name | [3-[(3-hydroxyphenyl)methyl]pyrrolidin-1-yl]-[1-(2-methoxyphenyl)pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 166614439 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | [3-[(3-hydroxyphenyl)methyl]pyrrolidin-1-yl]-[1-(2-methoxyphenyl)pyrazol-4-yl]methanone |
| SMILES | COc1ccccc1-n1cc(C(=O)N2CCC(Cc3cccc(O)c3)C2)cn1 |
| InChI | InChI=1S/C22H23N3O3/c1-28-21-8-3-2-7-20(21)25-15-18(13-23-25)22(27)24-10-9-17(14-24)11-16-5-4-6-19(26)12-16/h2-8,12-13,15,17,26H,9-11,14H2,1H3 |
| InChIKey | OAXNZTVMHALMJG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |