C22H31N3O2 — CID 166614962
1-[3-[(1R,2S,6R,9R)-6-cyclopropyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-oxopropyl]pyridin-2-one (PubChem CID 166614962) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-[3-[(1R,2S,6R,9R)-6-cyclopropyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-oxopropyl]pyridin-2-one.
| Compound Name | 1-[3-[(1R,2S,6R,9R)-6-cyclopropyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-oxopropyl]pyridin-2-one |
|---|---|
| PubChem CID | 166614962 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 1-[3-[(1R,2S,6R,9R)-6-cyclopropyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-3-oxopropyl]pyridin-2-one |
| SMILES | O=C(CCn1ccccc1=O)N1C[C@@H]2C[C@H](C1)[C@@H]1CCC[C@H](C3CC3)N1C2 |
| InChI | InChI=1S/C22H31N3O2/c26-21-6-1-2-10-23(21)11-9-22(27)24-13-16-12-18(15-24)20-5-3-4-19(17-7-8-17)25(20)14-16/h1-2,6,10,16-20H,3-5,7-9,11-15H2/t16-,18+,19+,20-/m0/s1 |
| InChIKey | RRLMURZMLSDSQV-NBYUQASBSA-N |
| XLogP | 2.35 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |