C21H19F6NO2S — CID 16661497
1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]-2-methylpropan-1-one (PubChem CID 16661497) has the molecular formula C21H19F6NO2S and a molecular weight of 463.44 g/mol. Its IUPAC name is 1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]-2-methylpropan-1-one.
| Compound Name | 1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 16661497 |
| Molecular Formula | C21H19F6NO2S |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CC(c2ccccc2)Sc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C21H19F6NO2S/c1-12(2)18(29)28-11-17(13-6-4-3-5-7-13)31-16-10-14(8-9-15(16)28)19(30,20(22,23)24)21(25,26)27/h3-10,12,17,30H,11H2,1-2H3 |
| InChIKey | QSUZEVRGJYDOLX-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |