About boranylformonitrile; N,N-dimethylhex-5-en-1-amine
boranylformonitrile; N,N-dimethylhex-5-en-1-amine (PubChem CID 16661506) has the molecular formula C9H17BN2
and a molecular weight of 164.06 g/mol.
Molecular Properties
| Compound Name | boranylformonitrile; N,N-dimethylhex-5-en-1-amine |
| PubChem CID | 16661506 |
| Molecular Formula | C9H17BN2 |
| Molecular Weight | 164.06 g/mol |
| Exact Mass | 164.15 |
| IUPAC Name | — |
| SMILES | C=CCCCCN(C)C.[B]C#N |
| InChI | InChI=1S/C8H17N.CBN/c1-4-5-6-7-8-9(2)3;2-1-3/h4H,1,5-8H2,2-3H3; |
| InChIKey | PJGJPKYDPDWKQB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.06 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze boranylformonitrile; N,N-dimethylhex-5-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boranylformonitrile; N,N-dimethylhex-5-en-1-amine?
The IUPAC name of boranylformonitrile; N,N-dimethylhex-5-en-1-amine (CID 16661506) is not available.
What is the SMILES notation for boranylformonitrile; N,N-dimethylhex-5-en-1-amine?
The canonical SMILES for boranylformonitrile; N,N-dimethylhex-5-en-1-amine is C=CCCCCN(C)C.[B]C#N.
What is the InChIKey of boranylformonitrile; N,N-dimethylhex-5-en-1-amine?
The InChIKey is PJGJPKYDPDWKQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.CBN/c1-4-5-6-7-8-9(2)3;2-1-3/h4H,1,5-8H2,2-3H3;.
What are the key properties of boranylformonitrile; N,N-dimethylhex-5-en-1-amine?
boranylformonitrile; N,N-dimethylhex-5-en-1-amine has a molecular weight of 164.06 g/mol, XLogP of 1.54, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for boranylformonitrile; N,N-dimethylhex-5-en-1-amine is sourced from PubChem (CID 16661506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).