About 3-[[1-[(5-propan-2-yl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-yl]methyl]phenol
3-[[1-[(5-propan-2-yl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-yl]methyl]phenol (PubChem CID 166615099) has the molecular formula C18H24N2O2
and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-[[1-[(5-propan-2-yl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-yl]methyl]phenol.
Molecular Properties
| Compound Name | 3-[[1-[(5-propan-2-yl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-yl]methyl]phenol |
| PubChem CID | 166615099 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 3-[[1-[(5-propan-2-yl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-yl]methyl]phenol |
| SMILES | CC(C)c1cc(CN2CCC(Cc3cccc(O)c3)C2)no1 |
| InChI | InChI=1S/C18H24N2O2/c1-13(2)18-10-16(19-22-18)12-20-7-6-15(11-20)8-14-4-3-5-17(21)9-14/h3-5,9-10,13,15,21H,6-8,11-12H2,1-2H3 |
| InChIKey | UCPPOWKHRLRDAG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[1-[(5-propan-2-yl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-yl]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-[(5-propan-2-yl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-yl]methyl]phenol?
The IUPAC name of 3-[[1-[(5-propan-2-yl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-yl]methyl]phenol (CID 166615099) is 3-[[1-[(5-propan-2-yl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-yl]methyl]phenol.
What is the SMILES notation for 3-[[1-[(5-propan-2-yl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-yl]methyl]phenol?
The canonical SMILES for 3-[[1-[(5-propan-2-yl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-yl]methyl]phenol is CC(C)c1cc(CN2CCC(Cc3cccc(O)c3)C2)no1.
What is the InChIKey of 3-[[1-[(5-propan-2-yl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-yl]methyl]phenol?
The InChIKey is UCPPOWKHRLRDAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O2/c1-13(2)18-10-16(19-22-18)12-20-7-6-15(11-20)8-14-4-3-5-17(21)9-14/h3-5,9-10,13,15,21H,6-8,11-12H2,1-2H3.
What are the key properties of 3-[[1-[(5-propan-2-yl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-yl]methyl]phenol?
3-[[1-[(5-propan-2-yl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-yl]methyl]phenol has a molecular weight of 300.40 g/mol, XLogP of 3.57, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-[(5-propan-2-yl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-yl]methyl]phenol is sourced from PubChem (CID 166615099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).