C22H21N5O3 — CID 166615381
(2'S,3R)-1'-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propanoyl]-2'-phenylspiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 166615381) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is (2'S,3R)-1'-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propanoyl]-2'-phenylspiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (2'S,3R)-1'-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propanoyl]-2'-phenylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 166615381 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | (2'S,3R)-1'-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propanoyl]-2'-phenylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | O=C(CCc1n[nH]c(=O)[nH]1)N1CC[C@]2(C(=O)Nc3ccccc32)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H21N5O3/c28-18(11-10-17-24-21(30)26-25-17)27-13-12-22(19(27)14-6-2-1-3-7-14)15-8-4-5-9-16(15)23-20(22)29/h1-9,19H,10-13H2,(H,23,29)(H2,24,25,26,30)/t19-,22+/m0/s1 |
| InChIKey | XGVFRXYNBPFGFO-SIKLNZKXSA-N |
| XLogP | 1.89 |
| TPSA | 110.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |