C22H28N4O4 — CID 166615939
methyl 3-[(3aS,6aS)-5-acetyl-3a-[(dimethylamino)methyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-5-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 166615939) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is methyl 3-[(3aS,6aS)-5-acetyl-3a-[(dimethylamino)methyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-5-phenyl-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 3-[(3aS,6aS)-5-acetyl-3a-[(dimethylamino)methyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-5-phenyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 166615939 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | methyl 3-[(3aS,6aS)-5-acetyl-3a-[(dimethylamino)methyl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-5-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1c(N2C[C@H]3CN(C(C)=O)C[C@@]3(CN(C)C)C2)noc1-c1ccccc1 |
| InChI | InChI=1S/C22H28N4O4/c1-15(27)25-10-17-11-26(14-22(17,13-25)12-24(2)3)20-18(21(28)29-4)19(30-23-20)16-8-6-5-7-9-16/h5-9,17H,10-14H2,1-4H3/t17-,22+/m1/s1 |
| InChIKey | LPJOUHCIDXJWRJ-VGSWGCGISA-N |
| XLogP | 1.97 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |