C32H36FN7O3 — CID 166615969
(1S,4S)-12-[2-(7-fluoro-2-methyl-1H-indol-3-yl)acetyl]-4-methyl-7-phenyl-3,6,8,9,12,17-hexazatricyclo[15.3.0.05,9]icosa-5,7-diene-2,16-dione (PubChem CID 166615969) has the molecular formula C32H36FN7O3 and a molecular weight of 585.68 g/mol. Its IUPAC name is (1S,4S)-12-[2-(7-fluoro-2-methyl-1H-indol-3-yl)acetyl]-4-methyl-7-phenyl-3,6,8,9,12,17-hexazatricyclo[15.3.0.05,9]icosa-5,7-diene-2,16-dione.
| Compound Name | (1S,4S)-12-[2-(7-fluoro-2-methyl-1H-indol-3-yl)acetyl]-4-methyl-7-phenyl-3,6,8,9,12,17-hexazatricyclo[15.3.0.05,9]icosa-5,7-diene-2,16-dione |
|---|---|
| PubChem CID | 166615969 |
| Molecular Formula | C32H36FN7O3 |
| Molecular Weight | 585.68 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | (1S,4S)-12-[2-(7-fluoro-2-methyl-1H-indol-3-yl)acetyl]-4-methyl-7-phenyl-3,6,8,9,12,17-hexazatricyclo[15.3.0.05,9]icosa-5,7-diene-2,16-dione |
| SMILES | Cc1[nH]c2c(F)cccc2c1CC(=O)N1CCCC(=O)N2CCC[C@H]2C(=O)N[C@@H](C)c2nc(-c3ccccc3)nn2CC1 |
| InChI | InChI=1S/C32H36FN7O3/c1-20-24(23-11-6-12-25(33)29(23)34-20)19-28(42)38-15-8-14-27(41)39-16-7-13-26(39)32(43)35-21(2)31-36-30(37-40(31)18-17-38)22-9-4-3-5-10-22/h3-6,9-12,21,26,34H,7-8,13-19H2,1-2H3,(H,35,43)/t21-,26-/m0/s1 |
| InChIKey | GOESYUSGMINWDW-LVXARBLLSA-N |
| XLogP | 3.91 |
| TPSA | 116.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|