C20H17F6NO2S — CID 16661647
1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl]-2-phenylethanone (PubChem CID 16661647) has the molecular formula C20H17F6NO2S and a molecular weight of 449.42 g/mol. Its IUPAC name is 1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl]-2-phenylethanone.
| Compound Name | 1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 16661647 |
| Molecular Formula | C20H17F6NO2S |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl]-2-phenylethanone |
| SMILES | CC1CN(C(=O)Cc2ccccc2)c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2S1 |
| InChI | InChI=1S/C20H17F6NO2S/c1-12-11-27(17(28)9-13-5-3-2-4-6-13)15-8-7-14(10-16(15)30-12)18(29,19(21,22)23)20(24,25)26/h2-8,10,12,29H,9,11H2,1H3 |
| InChIKey | GSSYATWCYIASKZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |