C19H23F6NO2S — CID 16661649
1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-4-methylpentan-1-one (PubChem CID 16661649) has the molecular formula C19H23F6NO2S and a molecular weight of 443.45 g/mol. Its IUPAC name is 1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-4-methylpentan-1-one.
| Compound Name | 1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-4-methylpentan-1-one |
|---|---|
| PubChem CID | 16661649 |
| Molecular Formula | C19H23F6NO2S |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-4-methylpentan-1-one |
| SMILES | CC[C@H]1CN(C(=O)CCC(C)C)c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2S1 |
| InChI | InChI=1S/C19H23F6NO2S/c1-4-13-10-26(16(27)8-5-11(2)3)14-7-6-12(9-15(14)29-13)17(28,18(20,21)22)19(23,24)25/h6-7,9,11,13,28H,4-5,8,10H2,1-3H3/t13-/m0/s1 |
| InChIKey | UBOZAUKNUMMYDA-ZDUSSCGKSA-N |
| XLogP | 5.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |