C18H19F6NO4S — CID 16661650
methyl 4-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-4-oxobutanoate (PubChem CID 16661650) has the molecular formula C18H19F6NO4S and a molecular weight of 459.41 g/mol. Its IUPAC name is methyl 4-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 16661650 |
| Molecular Formula | C18H19F6NO4S |
| Molecular Weight | 459.41 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | methyl 4-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-4-oxobutanoate |
| SMILES | CC[C@H]1CN(C(=O)CCC(=O)OC)c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2S1 |
| InChI | InChI=1S/C18H19F6NO4S/c1-3-11-9-25(14(26)6-7-15(27)29-2)12-5-4-10(8-13(12)30-11)16(28,17(19,20)21)18(22,23)24/h4-5,8,11,28H,3,6-7,9H2,1-2H3/t11-/m0/s1 |
| InChIKey | OCIYECGWYQNSEU-NSHDSACASA-N |
| XLogP | 4.17 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |