C22H27F6NO2S — CID 16661651
3-cyclohexyl-1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]propan-1-one (PubChem CID 16661651) has the molecular formula C22H27F6NO2S and a molecular weight of 483.52 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]propan-1-one.
| Compound Name | 3-cyclohexyl-1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 16661651 |
| Molecular Formula | C22H27F6NO2S |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 3-cyclohexyl-1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]propan-1-one |
| SMILES | CC[C@H]1CN(C(=O)CCC2CCCCC2)c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2S1 |
| InChI | InChI=1S/C22H27F6NO2S/c1-2-16-13-29(19(30)11-8-14-6-4-3-5-7-14)17-10-9-15(12-18(17)32-16)20(31,21(23,24)25)22(26,27)28/h9-10,12,14,16,31H,2-8,11,13H2,1H3/t16-/m0/s1 |
| InChIKey | HVLFTLFQTHXZIV-INIZCTEOSA-N |
| XLogP | 6.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |