C17H14FN3OS — CID 16661728
N-ethyl-4-fluoro-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 16661728) has the molecular formula C17H14FN3OS and a molecular weight of 327.38 g/mol. Its IUPAC name is N-ethyl-4-fluoro-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | N-ethyl-4-fluoro-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 16661728 |
| Molecular Formula | C17H14FN3OS |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N-ethyl-4-fluoro-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | CCN(C(=O)c1ccc(F)cc1)c1nc(-c2ccccn2)cs1 |
| InChI | InChI=1S/C17H14FN3OS/c1-2-21(16(22)12-6-8-13(18)9-7-12)17-20-15(11-23-17)14-5-3-4-10-19-14/h3-11H,2H2,1H3 |
| InChIKey | GMMCGAUGVKQWNP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |