C19H23N5O3 — CID 166617350
(2'S,3R)-1'-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propanoyl]-2'-propylspiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 166617350) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is (2'S,3R)-1'-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propanoyl]-2'-propylspiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (2'S,3R)-1'-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propanoyl]-2'-propylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 166617350 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (2'S,3R)-1'-[3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)propanoyl]-2'-propylspiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | CCC[C@@H]1N(C(=O)CCc2n[nH]c(=O)[nH]2)CC[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C19H23N5O3/c1-2-5-14-19(12-6-3-4-7-13(12)20-17(19)26)10-11-24(14)16(25)9-8-15-21-18(27)23-22-15/h3-4,6-7,14H,2,5,8-11H2,1H3,(H,20,26)(H2,21,22,23,27)/t14-,19+/m0/s1 |
| InChIKey | GXQJUYHQBHCNML-IFXJQAMLSA-N |
| XLogP | 1.32 |
| TPSA | 110.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |